Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Titanium foil, 0.032mm (0.0013in) thick, annealed, 99.7% (metals basis)
CAS: 7440-32-6 Molecular Formula: Ti Molecular Weight (g/mol): 47.87 MDL Number: MFCD00011264,MFCD00151301 InChI Key: RTAQQCXQSZGOHL-UHFFFAOYSA-N Synonym: oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 PubChem CID: 23963 ChEBI: CHEBI:33341 IUPAC Name: titanium SMILES: [Ti]
| PubChem CID | 23963 |
|---|---|
| CAS | 7440-32-6 |
| Molecular Weight (g/mol) | 47.87 |
| ChEBI | CHEBI:33341 |
| MDL Number | MFCD00011264,MFCD00151301 |
| SMILES | [Ti] |
| Synonym | oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 |
| IUPAC Name | titanium |
| InChI Key | RTAQQCXQSZGOHL-UHFFFAOYSA-N |
| Molecular Formula | Ti |
| Linear Formula | PBr2 |
|---|---|
| Molecular Weight (g/mol) | 270.69 |
| Color | Colorless to Yellow |
| Physical Form | Liquid |
| Chemical Name or Material | Phosphorus tribromide |
| SMILES | P(Br)(Br)Br |
| Merck Index | 15, 7469 |
| InChI Key | IPNPIHIZVLFAFP-UHFFFAOYSA-N |
| Density | 1.4880g/mL |
| PubChem CID | 24614 |
| Name Note | 1.0M Solution in Dichloromethane |
| Concentration or Composition (by Analyte or Components) | 0.9 to 1.1M |
| CAS | 75-09-2 |
| Health Hazard 3 | GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with wat |
| MDL Number | MFCD00011436 |
| Health Hazard 2 | GHS H Statement Suspected of causing cancer if inhaled. Causes severe skin burns and eye damage. May cause respiratory irritation. May cause drowsiness or dizziness. Reacts violently with water. |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | phosphorus tribromide,phosphorous tribromide,tribromophosphine,phosphorus iii bromide,phosphorous bromide,pbr3,phosphorus bromide,phosphorus bromide pbr3,unii-58r3866pua,tribro-mophosphine |
| IUPAC Name | tribromophosphane |
| Molecular Formula | Br3P |
| EINECS Number | 232-178-2 |
| Formula Weight | 270.69 |
| Specific Gravity | 1.488 |
Ruthenium(III) nitrosylnitrate, Ru 31.3% min
CAS: 34513-98-9 Molecular Formula: N4O10Ru MDL Number: MFCD00016313
| CAS | 34513-98-9 |
|---|---|
| MDL Number | MFCD00016313 |
| Molecular Formula | N4O10Ru |
Manganese(II) nitrate, 50% w/w aq. soln.
CAS: 10377-66-9 Molecular Formula: MnN2O6 Molecular Weight (g/mol): 178.946 MDL Number: MFCD00011112 InChI Key: MIVBAHRSNUNMPP-UHFFFAOYSA-N Synonym: manganese nitrate,manganous nitrate,manganese dinitrate,manganous dinitrate,manganese ii nitrate,manganese 2+ nitrate,nitric acid, manganese 2+ salt,manganese ii nitrate, anhydrous,manganesenitrate PubChem CID: 61511 IUPAC Name: manganese(2+);dinitrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Mn+2]
| PubChem CID | 61511 |
|---|---|
| CAS | 10377-66-9 |
| Molecular Weight (g/mol) | 178.946 |
| MDL Number | MFCD00011112 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].[Mn+2] |
| Synonym | manganese nitrate,manganous nitrate,manganese dinitrate,manganous dinitrate,manganese ii nitrate,manganese 2+ nitrate,nitric acid, manganese 2+ salt,manganese ii nitrate, anhydrous,manganesenitrate |
| IUPAC Name | manganese(2+);dinitrate |
| InChI Key | MIVBAHRSNUNMPP-UHFFFAOYSA-N |
| Molecular Formula | MnN2O6 |
Silver sulfate, ACS reagent
CAS: 10294-26-5 Molecular Formula: Ag2H2O4S Molecular Weight (g/mol): 313.81 InChI Key: YPNVIBVEFVRZPJ-UHFFFAOYSA-N Synonym: silver sulfate,disilver sulfate,disilver 1+ sulfate,unii-8qg6hv4zpo,disilver 1+ sulphate,sulfuric acid, disilver 1+ salt,8qg6hv4zpo,disilver 1+ ion sulfate,sulfuric acid, silver 1+ salt 1:2,sulfuric acid disilver i salt PubChem CID: 159865 IUPAC Name: disilver(1+) sulfuric acid SMILES: [Ag+].[Ag+].OS(O)(=O)=O
| PubChem CID | 159865 |
|---|---|
| CAS | 10294-26-5 |
| Molecular Weight (g/mol) | 313.81 |
| SMILES | [Ag+].[Ag+].OS(O)(=O)=O |
| Synonym | silver sulfate,disilver sulfate,disilver 1+ sulfate,unii-8qg6hv4zpo,disilver 1+ sulphate,sulfuric acid, disilver 1+ salt,8qg6hv4zpo,disilver 1+ ion sulfate,sulfuric acid, silver 1+ salt 1:2,sulfuric acid disilver i salt |
| IUPAC Name | disilver(1+) sulfuric acid |
| InChI Key | YPNVIBVEFVRZPJ-UHFFFAOYSA-N |
| Molecular Formula | Ag2H2O4S |
Potassium hexacyanocobaltate(III), 95%
CAS: 13963-58-1 Molecular Formula: C6CoK3N6 Molecular Weight (g/mol): 332.34 MDL Number: MFCD00011391
| CAS | 13963-58-1 |
|---|---|
| Molecular Weight (g/mol) | 332.34 |
| MDL Number | MFCD00011391 |
| Molecular Formula | C6CoK3N6 |
Potassium tungstate, 99.95%, for trace metal analysis, -100 mesh
CAS: 7790-60-5 Molecular Formula: K2O4W Molecular Weight (g/mol): 326.05 InChI Key: AAQNGTNRWPXMPB-UHFFFAOYSA-N Synonym: potassium tungstate,unii-t6vrm0ou6v,t6vrm0ou6v,dipotassium dioxido dioxo tungsten,dipotassium wolframate,potassium tungstate vi,tungstate wo42-, dipotassium, t-4,2k.wo4,potassium tungstate-w PubChem CID: 3084032 IUPAC Name: dipotassium;dioxido(dioxo)tungsten SMILES: [O-][W](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 3084032 |
|---|---|
| CAS | 7790-60-5 |
| Molecular Weight (g/mol) | 326.05 |
| SMILES | [O-][W](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium tungstate,unii-t6vrm0ou6v,t6vrm0ou6v,dipotassium dioxido dioxo tungsten,dipotassium wolframate,potassium tungstate vi,tungstate wo42-, dipotassium, t-4,2k.wo4,potassium tungstate-w |
| IUPAC Name | dipotassium;dioxido(dioxo)tungsten |
| InChI Key | AAQNGTNRWPXMPB-UHFFFAOYSA-N |
| Molecular Formula | K2O4W |
| Name Note | 0.51mm (0.02 in.) dia. |
|---|---|
| Form | Wire |
| Health Hazard 3 | P201-P202-P260-P264b-P270-P272-P280g-P281-P302+P352-P308+P313-P333+P313-P363-P501c |
| MDL Number | MFCD00148499 |
| Health Hazard 2 | GHS H Statement H372-H351-H317 Causes damage to organs through prolonged or repeated exposure. Suspected of causing cancer. May cause an allergic skin reaction. |
| Solubility Information | Insoluble in water. |
| Health Hazard 1 | H317-H350-H372 |
| Chemical Name or Material | Stainless Steel wire, Type 304 |
| TSCA | Yes |
| Recommended Storage | Ambient temperatures |
| Odor | Odorless |
| Avg. Mol. Wt. or Mol. Wt. Range | Fe:Cr:Ni; 70:19:11 wt% |
Potassium hydrogen phosphate trihydrate, Reagent Grade
CAS: 16788-57-1 Molecular Formula: H7K2O7P Molecular Weight (g/mol): 228.22 MDL Number: MFCD00149926 InChI Key: XQGPKZUNMMFTAL-UHFFFAOYSA-L Synonym: dipotassium hydrogen phosphate trihydrate,dipotassium hydrogen phosphate trihydrate,unii-rjk174x3tz,potassium hydrogenphosphate trihydrate,potassium phosphate dibasic trihydrate,potassium hydrogen phosphate trihydrate,potassium phosphate, dibasic, trihydrate,phosphoric acid, dipotassium salt, trihydrate,rjk174x3tz,dipotassium phosphate trihydrate PubChem CID: 16217523 IUPAC Name: dipotassium;hydrogen phosphate;trihydrate SMILES: O.O.O.[K+].[K+].OP([O-])([O-])=O
| PubChem CID | 16217523 |
|---|---|
| CAS | 16788-57-1 |
| Molecular Weight (g/mol) | 228.22 |
| MDL Number | MFCD00149926 |
| SMILES | O.O.O.[K+].[K+].OP([O-])([O-])=O |
| Synonym | dipotassium hydrogen phosphate trihydrate,dipotassium hydrogen phosphate trihydrate,unii-rjk174x3tz,potassium hydrogenphosphate trihydrate,potassium phosphate dibasic trihydrate,potassium hydrogen phosphate trihydrate,potassium phosphate, dibasic, trihydrate,phosphoric acid, dipotassium salt, trihydrate,rjk174x3tz,dipotassium phosphate trihydrate |
| IUPAC Name | dipotassium;hydrogen phosphate;trihydrate |
| InChI Key | XQGPKZUNMMFTAL-UHFFFAOYSA-L |
| Molecular Formula | H7K2O7P |
| CAS | 156-62-7 |
|---|---|
| MDL Number | MFCD00064894 |
| Molecular Formula | CCaN2 |
Titanium wire, 0.127mm (0.005in) dia, 99.99% (metals basis)
CAS: 7440-32-6 Molecular Formula: Ti Molecular Weight (g/mol): 47.87 MDL Number: MFCD00011264,MFCD00151301 InChI Key: RTAQQCXQSZGOHL-UHFFFAOYSA-N Synonym: oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 PubChem CID: 23963 ChEBI: CHEBI:33341 IUPAC Name: titanium SMILES: [Ti]
| PubChem CID | 23963 |
|---|---|
| CAS | 7440-32-6 |
| Molecular Weight (g/mol) | 47.87 |
| ChEBI | CHEBI:33341 |
| MDL Number | MFCD00011264,MFCD00151301 |
| SMILES | [Ti] |
| Synonym | oremet,alloy,cp,vt1,c.p.,contimet 30,jistp28,titanium-125,ii hydride,titan vt 1-1 |
| IUPAC Name | titanium |
| InChI Key | RTAQQCXQSZGOHL-UHFFFAOYSA-N |
| Molecular Formula | Ti |
Molybdenum(VI) oxide, Puratronic™, 99.9995% (metals basis excluding W)
CAS: 1313-27-5 Molecular Formula: MoO3 Molecular Weight (g/mol): 143.95 MDL Number: MFCD00003469 InChI Key: JKQOBWVOAYFWKG-UHFFFAOYSA-N Synonym: molybdenum trioxide,molybdenum vi oxide,molybdic anhydride,molybdic trioxide,molybdena,molybdic oxide,molybdenum oxide,molybdic acid anhydride,molybdenum peroxide PubChem CID: 14802 ChEBI: CHEBI:30627 IUPAC Name: trioxomolybdenum SMILES: O=[Mo](=O)=O
| PubChem CID | 14802 |
|---|---|
| CAS | 1313-27-5 |
| Molecular Weight (g/mol) | 143.95 |
| ChEBI | CHEBI:30627 |
| MDL Number | MFCD00003469 |
| SMILES | O=[Mo](=O)=O |
| Synonym | molybdenum trioxide,molybdenum vi oxide,molybdic anhydride,molybdic trioxide,molybdena,molybdic oxide,molybdenum oxide,molybdic acid anhydride,molybdenum peroxide |
| IUPAC Name | trioxomolybdenum |
| InChI Key | JKQOBWVOAYFWKG-UHFFFAOYSA-N |
| Molecular Formula | MoO3 |
Nickel powder, -325 mesh, typically 99.8% (metals basis), Thermo Scientific Chemicals
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |
Copper(I) chloride, 97%
CAS: 7758-89-6 Molecular Formula: ClCu Molecular Weight (g/mol): 98.996 MDL Number: MFCD00010971 InChI Key: OXBLHERUFWYNTN-UHFFFAOYSA-M Synonym: cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech PubChem CID: 62652 ChEBI: CHEBI:53472 IUPAC Name: chlorocopper SMILES: Cl[Cu]
| PubChem CID | 62652 |
|---|---|
| CAS | 7758-89-6 |
| Molecular Weight (g/mol) | 98.996 |
| ChEBI | CHEBI:53472 |
| MDL Number | MFCD00010971 |
| SMILES | Cl[Cu] |
| Synonym | cuprous chloride,copper i chloride,copper chloride cucl,copper monochloride,dicopper dichloride,copper 1+ chloride,cucl,chlorid medny czech |
| IUPAC Name | chlorocopper |
| InChI Key | OXBLHERUFWYNTN-UHFFFAOYSA-M |
| Molecular Formula | ClCu |
Niobium foil, 0.25mm (0.01in) thick, annealed, 99.8% (metals basis)
CAS: 3-1-7440 Molecular Formula: Nb Molecular Weight (g/mol): 92.91 MDL Number: MFCD00011126 InChI Key: GUCVJGMIXFAOAE-UHFFFAOYSA-N Synonym: columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio PubChem CID: 23936 ChEBI: CHEBI:33344 IUPAC Name: niobium SMILES: [Nb]
| PubChem CID | 23936 |
|---|---|
| CAS | 3-1-7440 |
| Molecular Weight (g/mol) | 92.91 |
| ChEBI | CHEBI:33344 |
| MDL Number | MFCD00011126 |
| SMILES | [Nb] |
| Synonym | columbium,element,niobium-93,powder,foil,rod,vn 1,foil, 0.25mm 0.01in thick,columbio,niobio |
| IUPAC Name | niobium |
| InChI Key | GUCVJGMIXFAOAE-UHFFFAOYSA-N |
| Molecular Formula | Nb |